C22H23FN4O2 — CID 110179179
ethyl N-[2-amino-6-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-3-pyridinyl]carbamate (PubChem CID 110179179) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is ethyl N-[2-amino-6-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[2-amino-6-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110179179 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | ethyl N-[2-amino-6-[[1-(4-fluorophenyl)-2-phenylethyl]amino]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC(Cc2ccccc2)c2ccc(F)cc2)nc1N |
| InChI | InChI=1S/C22H23FN4O2/c1-2-29-22(28)26-18-12-13-20(27-21(18)24)25-19(14-15-6-4-3-5-7-15)16-8-10-17(23)11-9-16/h3-13,19H,2,14H2,1H3,(H,26,28)(H3,24,25,27) |
| InChIKey | ZXHHXOUMBAJIRD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |