C35H42O11SSi — CID 11017935
[(3R,4S,5S)-2,4-diacetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate (PubChem CID 11017935) has the molecular formula C35H42O11SSi and a molecular weight of 698.86 g/mol. Its IUPAC name is [(3R,4S,5S)-2,4-diacetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5S)-2,4-diacetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11017935 |
| Molecular Formula | C35H42O11SSi |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | [(3R,4S,5S)-2,4-diacetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@@](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C35H42O11SSi/c1-24-18-20-28(21-19-24)47(39,40)41-22-35(32(44-26(3)37)31(43-25(2)36)33(46-35)45-27(4)38)23-42-48(34(5,6)7,29-14-10-8-11-15-29)30-16-12-9-13-17-30/h8-21,31-33H,22-23H2,1-7H3/t31-,32+,33?,35-/m1/s1 |
| InChIKey | FCACQUQBMMRZTH-FUSPTILGSA-N |
| XLogP | 3.80 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|