C20H22N6O3S2+2 — CID 11017982
3-(1-methylpyridin-1-ium-3-yl)-4-[2-[2-[[4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazol-3-yl]oxy]ethoxy]ethoxy]-1,2,5-thiadiazole (PubChem CID 11017982) has the molecular formula C20H22N6O3S2+2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 3-(1-methylpyridin-1-ium-3-yl)-4-[2-[2-[[4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazol-3-yl]oxy]ethoxy]ethoxy]-1,2,5-thiadiazole.
| Compound Name | 3-(1-methylpyridin-1-ium-3-yl)-4-[2-[2-[[4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazol-3-yl]oxy]ethoxy]ethoxy]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 11017982 |
| Molecular Formula | C20H22N6O3S2+2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-(1-methylpyridin-1-ium-3-yl)-4-[2-[2-[[4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazol-3-yl]oxy]ethoxy]ethoxy]-1,2,5-thiadiazole |
| SMILES | C[n+]1cccc(-c2nsnc2OCCOCCOc2nsnc2-c2ccc[n+](C)c2)c1 |
| InChI | InChI=1S/C20H22N6O3S2/c1-25-7-3-5-15(13-25)17-19(23-30-21-17)28-11-9-27-10-12-29-20-18(22-31-24-20)16-6-4-8-26(2)14-16/h3-8,13-14H,9-12H2,1-2H3/q+2 |
| InChIKey | KCUUTSQMSSVZIB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|