C21H26NO3+ — CID 11018
View drug profile → poldine(1,1-dimethylpyrrolidin-1-ium-2-yl)methyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 11018) has the molecular formula C21H26NO3+ and a molecular weight of 340.44 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-2-yl)methyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-2-yl)methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 11018 |
| Molecular Formula | C21H26NO3+ |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-2-yl)methyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(C)CCCC1COC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26NO3/c1-22(2)15-9-14-19(22)16-25-20(23)21(24,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19,24H,9,14-16H2,1-2H3/q+1 |
| InChIKey | CQRKVVAGMJJJSR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|