C35H38Cl2MoN2O4 — CID 11018006
(1S,7S)-4,4-dichloro-9,9-dimethyl-2,2,6,6-tetraphenyl-8,10-dioxa-3,5-diaza-4λ6-molybdabicyclo[5.3.0]deca-3,4-diene;1,2-dimethoxyethane (PubChem CID 11018006) has the molecular formula C35H38Cl2MoN2O4 and a molecular weight of 717.55 g/mol. Its IUPAC name is (1S,7S)-4,4-dichloro-9,9-dimethyl-2,2,6,6-tetraphenyl-8,10-dioxa-3,5-diaza-4λ6-molybdabicyclo[5.3.0]deca-3,4-diene;1,2-dimethoxyethane.
| Compound Name | (1S,7S)-4,4-dichloro-9,9-dimethyl-2,2,6,6-tetraphenyl-8,10-dioxa-3,5-diaza-4λ6-molybdabicyclo[5.3.0]deca-3,4-diene;1,2-dimethoxyethane |
|---|---|
| PubChem CID | 11018006 |
| Molecular Formula | C35H38Cl2MoN2O4 |
| Molecular Weight | 717.55 g/mol |
| Exact Mass | 718.13 |
| IUPAC Name | (1S,7S)-4,4-dichloro-9,9-dimethyl-2,2,6,6-tetraphenyl-8,10-dioxa-3,5-diaza-4λ6-molybdabicyclo[5.3.0]deca-3,4-diene;1,2-dimethoxyethane |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)C(c1ccccc1)(c1ccccc1)N=[Mo](Cl)(Cl)=NC2(c1ccccc1)c1ccccc1.COCCOC |
| InChI | InChI=1S/C31H28N2O2.C4H10O2.2ClH.Mo/c1-29(2)34-27(30(32,23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(35-29)31(33,25-19-11-5-12-20-25)26-21-13-6-14-22-26;1-5-3-4-6-2;;;/h3-22,27-28H,1-2H3;3-4H2,1-2H3;2*1H;/q;;;;+2/p-2/t27-,28-;;;;/m1..../s1 |
| InChIKey | HDABQIJESHIXCL-SPWNPGBKSA-L |
| XLogP | 8.52 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.55 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|