About N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide
N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 110180187) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide |
| PubChem CID | 110180187 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | CC(=O)NC1CCc2cc(C)cc(C)c21 |
| InChI | InChI=1S/C13H17NO/c1-8-6-9(2)13-11(7-8)4-5-12(13)14-10(3)15/h6-7,12H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | CXWJXHNVEISOAP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide?
The IUPAC name of N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide (CID 110180187) is N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide.
What is the SMILES notation for N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide?
The canonical SMILES for N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide is CC(=O)NC1CCc2cc(C)cc(C)c21.
What is the InChIKey of N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide?
The InChIKey is CXWJXHNVEISOAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-8-6-9(2)13-11(7-8)4-5-12(13)14-10(3)15/h6-7,12H,4-5H2,1-3H3,(H,14,15).
What are the key properties of N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide?
N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide has a molecular weight of 203.28 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,7-dimethyl-2,3-dihydro-1H-inden-1-yl)acetamide is sourced from PubChem (CID 110180187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).