About 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one
1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one (PubChem CID 110180343) has the molecular formula C23H17N3O
and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one.
Molecular Properties
| Compound Name | 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one |
| PubChem CID | 110180343 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one |
| SMILES | CC1(c2ccccc2)N=C(c2ccccc2)c2nc3ccccc3c(=O)n21 |
| InChI | InChI=1S/C23H17N3O/c1-23(17-12-6-3-7-13-17)25-20(16-10-4-2-5-11-16)21-24-19-15-9-8-14-18(19)22(27)26(21)23/h2-15H,1H3 |
| InChIKey | NJOZQWWVQUETQO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one?
The IUPAC name of 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one (CID 110180343) is 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one.
What is the SMILES notation for 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one?
The canonical SMILES for 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one is CC1(c2ccccc2)N=C(c2ccccc2)c2nc3ccccc3c(=O)n21.
What is the InChIKey of 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one?
The InChIKey is NJOZQWWVQUETQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O/c1-23(17-12-6-3-7-13-17)25-20(16-10-4-2-5-11-16)21-24-19-15-9-8-14-18(19)22(27)26(21)23/h2-15H,1H3.
What are the key properties of 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one?
1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one has a molecular weight of 351.41 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,3-diphenylimidazo[5,1-b]quinazolin-9-one is sourced from PubChem (CID 110180343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).