C33H55NO6S — CID 110180617
(1-carboxy-2-sulfanylethyl)azanium;10-hydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 110180617) has the molecular formula C33H55NO6S and a molecular weight of 593.87 g/mol. Its IUPAC name is (1-carboxy-2-sulfanylethyl)azanium;10-hydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | (1-carboxy-2-sulfanylethyl)azanium;10-hydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 110180617 |
| Molecular Formula | C33H55NO6S |
| Molecular Weight | 593.87 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | (1-carboxy-2-sulfanylethyl)azanium;10-hydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CC1(C)CCC2(C(=O)[O-])CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C2C1.[NH3+]C(CS)C(=O)O |
| InChI | InChI=1S/C30H48O4.C3H7NO2S/c1-25(2)13-15-30(24(33)34)16-14-28(5)19(20(30)17-25)7-8-22-26(3)11-10-23(32)27(4,18-31)21(26)9-12-29(22,28)6;4-2(1-7)3(5)6/h7,20-23,31-32H,8-18H2,1-6H3,(H,33,34);2,7H,1,4H2,(H,5,6) |
| InChIKey | ODFCRSIMMXVRDW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|