C23H34Cl2N2O6 — CID 110181188
1-[4-(4-methoxyphenyl)piperazine-1,4-diium-1-yl]-3-(3,4,5-trimethoxyphenoxy)propan-2-ol dichloride (PubChem CID 110181188) has the molecular formula C23H34Cl2N2O6 and a molecular weight of 505.44 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazine-1,4-diium-1-yl]-3-(3,4,5-trimethoxyphenoxy)propan-2-ol dichloride.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazine-1,4-diium-1-yl]-3-(3,4,5-trimethoxyphenoxy)propan-2-ol dichloride |
|---|---|
| PubChem CID | 110181188 |
| Molecular Formula | C23H34Cl2N2O6 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazine-1,4-diium-1-yl]-3-(3,4,5-trimethoxyphenoxy)propan-2-ol dichloride |
| SMILES | COc1ccc([NH+]2CC[NH+](CC(O)COc3cc(OC)c(OC)c(OC)c3)CC2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C23H32N2O6.2ClH/c1-27-19-7-5-17(6-8-19)25-11-9-24(10-12-25)15-18(26)16-31-20-13-21(28-2)23(30-4)22(14-20)29-3;;/h5-8,13-14,18,26H,9-12,15-16H2,1-4H3;2*1H |
| InChIKey | VWRNFWSCRAYZJL-UHFFFAOYSA-N |
| XLogP | -6.42 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | -6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|