C20H14Br2O8S4Se2 — CID 11018285
dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1,3-dibromo-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11018285) has the molecular formula C20H14Br2O8S4Se2 and a molecular weight of 828.32 g/mol. Its IUPAC name is dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1,3-dibromo-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1,3-dibromo-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11018285 |
| Molecular Formula | C20H14Br2O8S4Se2 |
| Molecular Weight | 828.32 g/mol |
| Exact Mass | 827.63 |
| IUPAC Name | dimethyl 2-[3-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]-1,3-dibromo-2-(1,3-diselenol-2-ylidene)propylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C(Br)C(=C2[Se]C=C[Se]2)C(Br)=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C20H14Br2O8S4Se2/c1-27-14(23)10-11(15(24)28-2)32-18(31-10)8(21)7(20-35-5-6-36-20)9(22)19-33-12(16(25)29-3)13(34-19)17(26)30-4/h5-6H,1-4H3 |
| InChIKey | ZHHSPTMRFITGSX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|