C7H8N8 — CID 110183616
2-[cyanomethyl-(4,6-diamino-1,3,5-triazin-2-yl)amino]acetonitrile (PubChem CID 110183616) has the molecular formula C7H8N8 and a molecular weight of 204.20 g/mol. Its IUPAC name is 2-[cyanomethyl-(4,6-diamino-1,3,5-triazin-2-yl)amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-(4,6-diamino-1,3,5-triazin-2-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 110183616 |
| Molecular Formula | C7H8N8 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-[cyanomethyl-(4,6-diamino-1,3,5-triazin-2-yl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H8N8/c8-1-3-15(4-2-9)7-13-5(10)12-6(11)14-7/h3-4H2,(H4,10,11,12,13,14) |
| InChIKey | FIRARLNBQOSSNJ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|