C21H25NO — CID 110184706
2-(3-benzylpiperidin-1-yl)-1-phenylpropan-1-one (PubChem CID 110184706) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-(3-benzylpiperidin-1-yl)-1-phenylpropan-1-one.
| Compound Name | 2-(3-benzylpiperidin-1-yl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 110184706 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-(3-benzylpiperidin-1-yl)-1-phenylpropan-1-one |
| SMILES | CC(C(=O)c1ccccc1)N1CCCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H25NO/c1-17(21(23)20-12-6-3-7-13-20)22-14-8-11-19(16-22)15-18-9-4-2-5-10-18/h2-7,9-10,12-13,17,19H,8,11,14-16H2,1H3 |
| InChIKey | LPWHCWWDRHHERJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |