C17H33N3O3S — CID 110184817
2-amino-3-[10-(cyclopropylcarbamoylamino)decylsulfanyl]propanoic acid (PubChem CID 110184817) has the molecular formula C17H33N3O3S and a molecular weight of 359.54 g/mol. Its IUPAC name is 2-amino-3-[10-(cyclopropylcarbamoylamino)decylsulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[10-(cyclopropylcarbamoylamino)decylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 110184817 |
| Molecular Formula | C17H33N3O3S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-amino-3-[10-(cyclopropylcarbamoylamino)decylsulfanyl]propanoic acid |
| SMILES | NC(CSCCCCCCCCCCNC(=O)NC1CC1)C(=O)O |
| InChI | InChI=1S/C17H33N3O3S/c18-15(16(21)22)13-24-12-8-6-4-2-1-3-5-7-11-19-17(23)20-14-9-10-14/h14-15H,1-13,18H2,(H,21,22)(H2,19,20,23) |
| InChIKey | BUBCRLLWHAVQKK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|