C15H23ClN2O — CID 110185150
(3-cyclohexyl-3-oxopropyl)-(pyridin-3-ylmethyl)azanium chloride (PubChem CID 110185150) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is (3-cyclohexyl-3-oxopropyl)-(pyridin-3-ylmethyl)azanium chloride.
| Compound Name | (3-cyclohexyl-3-oxopropyl)-(pyridin-3-ylmethyl)azanium chloride |
|---|---|
| PubChem CID | 110185150 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3-cyclohexyl-3-oxopropyl)-(pyridin-3-ylmethyl)azanium chloride |
| SMILES | O=C(CC[NH2+]Cc1cccnc1)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C15H22N2O.ClH/c18-15(14-6-2-1-3-7-14)8-10-17-12-13-5-4-9-16-11-13;/h4-5,9,11,14,17H,1-3,6-8,10,12H2;1H |
| InChIKey | WUHWFOIVZNGFOJ-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 46.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|