C16H23ClN2O2S — CID 110185794
2-chloro-6-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]sulfanylpyridine (PubChem CID 110185794) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is 2-chloro-6-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]sulfanylpyridine.
| Compound Name | 2-chloro-6-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]sulfanylpyridine |
|---|---|
| PubChem CID | 110185794 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-chloro-6-[1-[2-(1,3-dioxan-2-yl)ethyl]piperidin-4-yl]sulfanylpyridine |
| SMILES | Clc1cccc(SC2CCN(CCC3OCCCO3)CC2)n1 |
| InChI | InChI=1S/C16H23ClN2O2S/c17-14-3-1-4-15(18-14)22-13-5-8-19(9-6-13)10-7-16-20-11-2-12-21-16/h1,3-4,13,16H,2,5-12H2 |
| InChIKey | ZLMCFPURYHAXFJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|