C17H27ClN2O2S — CID 110185796
2-chloro-6-[1-(3,3-diethoxypropyl)piperidin-4-yl]sulfanylpyridine (PubChem CID 110185796) has the molecular formula C17H27ClN2O2S and a molecular weight of 358.94 g/mol. Its IUPAC name is 2-chloro-6-[1-(3,3-diethoxypropyl)piperidin-4-yl]sulfanylpyridine.
| Compound Name | 2-chloro-6-[1-(3,3-diethoxypropyl)piperidin-4-yl]sulfanylpyridine |
|---|---|
| PubChem CID | 110185796 |
| Molecular Formula | C17H27ClN2O2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-chloro-6-[1-(3,3-diethoxypropyl)piperidin-4-yl]sulfanylpyridine |
| SMILES | CCOC(CCN1CCC(Sc2cccc(Cl)n2)CC1)OCC |
| InChI | InChI=1S/C17H27ClN2O2S/c1-3-21-17(22-4-2)10-13-20-11-8-14(9-12-20)23-16-7-5-6-15(18)19-16/h5-7,14,17H,3-4,8-13H2,1-2H3 |
| InChIKey | ASYUIHHHPSRFHS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|