About 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine
1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine (PubChem CID 110186011) has the molecular formula C21H29NO2S2
and a molecular weight of 391.60 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine |
| PubChem CID | 110186011 |
| Molecular Formula | C21H29NO2S2 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine |
| SMILES | CCOC(CCN1CCC(=C(c2ccsc2)c2ccsc2)CC1)OCC |
| InChI | InChI=1S/C21H29NO2S2/c1-3-23-20(24-4-2)7-12-22-10-5-17(6-11-22)21(18-8-13-25-15-18)19-9-14-26-16-19/h8-9,13-16,20H,3-7,10-12H2,1-2H3 |
| InChIKey | OWWQUCSELYAABF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine?
The IUPAC name of 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine (CID 110186011) is 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine.
What is the SMILES notation for 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine?
The canonical SMILES for 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine is CCOC(CCN1CCC(=C(c2ccsc2)c2ccsc2)CC1)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine?
The InChIKey is OWWQUCSELYAABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO2S2/c1-3-23-20(24-4-2)7-12-22-10-5-17(6-11-22)21(18-8-13-25-15-18)19-9-14-26-16-19/h8-9,13-16,20H,3-7,10-12H2,1-2H3.
What are the key properties of 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine?
1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine has a molecular weight of 391.60 g/mol, XLogP of 5.50, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)-4-[di(thiophen-3-yl)methylidene]piperidine is sourced from PubChem (CID 110186011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).