C10H12S8 — CID 11018625
2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol (PubChem CID 11018625) has the molecular formula C10H12S8 and a molecular weight of 388.74 g/mol. Its IUPAC name is 2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol.
| Compound Name | 2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol |
|---|---|
| PubChem CID | 11018625 |
| Molecular Formula | C10H12S8 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 387.87 |
| IUPAC Name | 2-[4,5-bis(ethylsulfanyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dithiol |
| SMILES | CCSC1=C(SCC)SC(=C2SC(S)=C(S)S2)S1 |
| InChI | InChI=1S/C10H12S8/c1-3-13-7-8(14-4-2)18-10(17-7)9-15-5(11)6(12)16-9/h11-12H,3-4H2,1-2H3 |
| InChIKey | VJNIUVKQHHPENC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|