C17H21ClN4O — CID 110186885
8-[2-(1-methylpyrrolidin-1-ium-2-yl)ethyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride (PubChem CID 110186885) has the molecular formula C17H21ClN4O and a molecular weight of 332.83 g/mol. Its IUPAC name is 8-[2-(1-methylpyrrolidin-1-ium-2-yl)ethyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride.
| Compound Name | 8-[2-(1-methylpyrrolidin-1-ium-2-yl)ethyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride |
|---|---|
| PubChem CID | 110186885 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 8-[2-(1-methylpyrrolidin-1-ium-2-yl)ethyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride |
| SMILES | C[NH+]1CCCC1CCn1c(=O)c2cccn2c2ncccc21.[Cl-] |
| InChI | InChI=1S/C17H20N4O.ClH/c1-19-10-3-5-13(19)8-12-21-14-6-2-9-18-16(14)20-11-4-7-15(20)17(21)22;/h2,4,6-7,9,11,13H,3,5,8,10,12H2,1H3;1H |
| InChIKey | RIPVCLXIBVCBGE-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 43.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |