C25H45NO3 — CID 110188216
1-[[(E)-octadec-9-enoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 110188216) has the molecular formula C25H45NO3 and a molecular weight of 407.64 g/mol. Its IUPAC name is 1-[[(E)-octadec-9-enoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(E)-octadec-9-enoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 110188216 |
| Molecular Formula | C25H45NO3 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | 1-[[(E)-octadec-9-enoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C25H45NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(27)26-25(24(28)29)21-18-16-19-22-25/h9-10H,2-8,11-22H2,1H3,(H,26,27)(H,28,29)/b10-9+ |
| InChIKey | WUYCQPQLHQZZQJ-MDZDMXLPSA-N |
| XLogP | 6.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|