About pyrrolo[1,2-a]pyrazine
pyrrolo[1,2-a]pyrazine (PubChem CID 11018843) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is pyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | pyrrolo[1,2-a]pyrazine |
| PubChem CID | 11018843 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | pyrrolo[1,2-a]pyrazine |
| SMILES | c1cc2cnccn2c1 |
| InChI | InChI=1S/C7H6N2/c1-2-7-6-8-3-5-9(7)4-1/h1-6H |
| InChIKey | QSLLFYVBWXWUQT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[1,2-a]pyrazine?
The IUPAC name of pyrrolo[1,2-a]pyrazine (CID 11018843) is pyrrolo[1,2-a]pyrazine.
What is the SMILES notation for pyrrolo[1,2-a]pyrazine?
The canonical SMILES for pyrrolo[1,2-a]pyrazine is c1cc2cnccn2c1.
What is the InChIKey of pyrrolo[1,2-a]pyrazine?
The InChIKey is QSLLFYVBWXWUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-7-6-8-3-5-9(7)4-1/h1-6H.
What are the key properties of pyrrolo[1,2-a]pyrazine?
pyrrolo[1,2-a]pyrazine has a molecular weight of 118.14 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 11018843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).