About trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate
trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate (PubChem CID 11018870) has the molecular formula C7H10O2
and a molecular weight of 126.16 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate |
| PubChem CID | 11018870 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@H]1C(=O)OC |
| InChI | InChI=1S/C7H10O2/c1-3-5-4-6(5)7(8)9-2/h3,5-6H,1,4H2,2H3/t5-,6+/m0/s1 |
| InChIKey | NIKRQZZKLVNECO-NTSWFWBYSA-N |
| XLogP | 0.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate?
The IUPAC name of trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate (CID 11018870) is trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate is C=C[C@H]1C[C@H]1C(=O)OC.
What is the InChIKey of trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate?
The InChIKey is NIKRQZZKLVNECO-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H10O2/c1-3-5-4-6(5)7(8)9-2/h3,5-6H,1,4H2,2H3/t5-,6+/m0/s1.
What are the key properties of trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate?
trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate has a molecular weight of 126.16 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,2R)-2-ethenylcyclopropane-1-carboxylate is sourced from PubChem (CID 11018870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).