About (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde
(2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde (PubChem CID 11018871) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde.
Molecular Properties
| Compound Name | (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde |
| PubChem CID | 11018871 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde |
| SMILES | CC1=CCO[C@H](C=O)C1 |
| InChI | InChI=1S/C7H10O2/c1-6-2-3-9-7(4-6)5-8/h2,5,7H,3-4H2,1H3/t7-/m0/s1 |
| InChIKey | XVOBRVYBCPPREW-ZETCQYMHSA-N |
| XLogP | 0.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde?
The IUPAC name of (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde (CID 11018871) is (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde.
What is the SMILES notation for (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde?
The canonical SMILES for (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde is CC1=CCO[C@H](C=O)C1.
What is the InChIKey of (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde?
The InChIKey is XVOBRVYBCPPREW-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H10O2/c1-6-2-3-9-7(4-6)5-8/h2,5,7H,3-4H2,1H3/t7-/m0/s1.
What are the key properties of (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde?
(2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde has a molecular weight of 126.15 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methyl-3,6-dihydro-2H-pyran-2-carbaldehyde is sourced from PubChem (CID 11018871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).