About N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide
N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 1101889) has the molecular formula C23H16N2OS
and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 1101889 |
| Molecular Formula | C23H16N2OS |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)Cc2ccccc2-3)cs1)c1ccccc1 |
| InChI | InChI=1S/C23H16N2OS/c26-22(15-6-2-1-3-7-15)25-23-24-21(14-27-23)17-10-11-20-18(13-17)12-16-8-4-5-9-19(16)20/h1-11,13-14H,12H2,(H,24,25,26) |
| InChIKey | JDTDDIGNQWTQCT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide?
The IUPAC name of N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide (CID 1101889) is N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide is O=C(Nc1nc(-c2ccc3c(c2)Cc2ccccc2-3)cs1)c1ccccc1.
What is the InChIKey of N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide?
The InChIKey is JDTDDIGNQWTQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2OS/c26-22(15-6-2-1-3-7-15)25-23-24-21(14-27-23)17-10-11-20-18(13-17)12-16-8-4-5-9-19(16)20/h1-11,13-14H,12H2,(H,24,25,26).
What are the key properties of N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide?
N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide has a molecular weight of 368.46 g/mol, XLogP of 5.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 1101889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).