About 1,2,3-benzotriazine
1,2,3-benzotriazine (PubChem CID 11018899) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is 1,2,3-benzotriazine.
Molecular Properties
| Compound Name | 1,2,3-benzotriazine |
| PubChem CID | 11018899 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 1,2,3-benzotriazine |
| SMILES | c1ccc2nnncc2c1 |
| InChI | InChI=1S/C7H5N3/c1-2-4-7-6(3-1)5-8-10-9-7/h1-5H |
| InChIKey | OWQPOVKKUWUEKE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,3-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-benzotriazine?
The IUPAC name of 1,2,3-benzotriazine (CID 11018899) is 1,2,3-benzotriazine.
What is the SMILES notation for 1,2,3-benzotriazine?
The canonical SMILES for 1,2,3-benzotriazine is c1ccc2nnncc2c1.
What is the InChIKey of 1,2,3-benzotriazine?
The InChIKey is OWQPOVKKUWUEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c1-2-4-7-6(3-1)5-8-10-9-7/h1-5H.
What are the key properties of 1,2,3-benzotriazine?
1,2,3-benzotriazine has a molecular weight of 131.14 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-benzotriazine is sourced from PubChem (CID 11018899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).