About (2S)-2-benzyloxirane
(2S)-2-benzyloxirane (PubChem CID 11018915) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is (2S)-2-benzyloxirane.
Molecular Properties
| Compound Name | (2S)-2-benzyloxirane |
| PubChem CID | 11018915 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (2S)-2-benzyloxirane |
| SMILES | c1ccc(C[C@H]2CO2)cc1 |
| InChI | InChI=1S/C9H10O/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,9H,6-7H2/t9-/m0/s1 |
| InChIKey | JFDMLXYWGLECEY-VIFPVBQESA-N |
| XLogP | 1.63 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-benzyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-benzyloxirane?
The IUPAC name of (2S)-2-benzyloxirane (CID 11018915) is (2S)-2-benzyloxirane.
What is the SMILES notation for (2S)-2-benzyloxirane?
The canonical SMILES for (2S)-2-benzyloxirane is c1ccc(C[C@H]2CO2)cc1.
What is the InChIKey of (2S)-2-benzyloxirane?
The InChIKey is JFDMLXYWGLECEY-VIFPVBQESA-N. The full InChI is InChI=1S/C9H10O/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,9H,6-7H2/t9-/m0/s1.
What are the key properties of (2S)-2-benzyloxirane?
(2S)-2-benzyloxirane has a molecular weight of 134.18 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-benzyloxirane is sourced from PubChem (CID 11018915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).