About 2-sulfanylbenzonitrile
2-sulfanylbenzonitrile (PubChem CID 11018926) has the molecular formula C7H5NS
and a molecular weight of 135.19 g/mol. Its IUPAC name is 2-sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 2-sulfanylbenzonitrile |
| PubChem CID | 11018926 |
| Molecular Formula | C7H5NS |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 2-sulfanylbenzonitrile |
| SMILES | N#Cc1ccccc1S |
| InChI | InChI=1S/C7H5NS/c8-5-6-3-1-2-4-7(6)9/h1-4,9H |
| InChIKey | AOYOBWSGCQMROU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylbenzonitrile?
The IUPAC name of 2-sulfanylbenzonitrile (CID 11018926) is 2-sulfanylbenzonitrile.
What is the SMILES notation for 2-sulfanylbenzonitrile?
The canonical SMILES for 2-sulfanylbenzonitrile is N#Cc1ccccc1S.
What is the InChIKey of 2-sulfanylbenzonitrile?
The InChIKey is AOYOBWSGCQMROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS/c8-5-6-3-1-2-4-7(6)9/h1-4,9H.
What are the key properties of 2-sulfanylbenzonitrile?
2-sulfanylbenzonitrile has a molecular weight of 135.19 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylbenzonitrile is sourced from PubChem (CID 11018926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).