C10H18N6O — CID 110189631
1-[4-(diethylamino)-1,3,5-triazin-2-yl]-1,3-dimethylurea (PubChem CID 110189631) has the molecular formula C10H18N6O and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[4-(diethylamino)-1,3,5-triazin-2-yl]-1,3-dimethylurea.
| Compound Name | 1-[4-(diethylamino)-1,3,5-triazin-2-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 110189631 |
| Molecular Formula | C10H18N6O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-[4-(diethylamino)-1,3,5-triazin-2-yl]-1,3-dimethylurea |
| SMILES | CCN(CC)c1ncnc(N(C)C(=O)NC)n1 |
| InChI | InChI=1S/C10H18N6O/c1-5-16(6-2)9-13-7-12-8(14-9)15(4)10(17)11-3/h7H,5-6H2,1-4H3,(H,11,17) |
| InChIKey | JLPCMPAYXMSUPS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |