About 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride
6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride (PubChem CID 11019) has the molecular formula C23H30ClNO2
and a molecular weight of 387.95 g/mol. Its IUPAC name is 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride.
Molecular Properties
| Compound Name | 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride |
| PubChem CID | 11019 |
| Molecular Formula | C23H30ClNO2 |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride |
| SMILES | CCC(=O)C(CC(C)N1CCOCC1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C23H29NO2.ClH/c1-3-22(25)23(20-10-6-4-7-11-20,21-12-8-5-9-13-21)18-19(2)24-14-16-26-17-15-24;/h4-13,19H,3,14-18H2,1-2H3;1H |
| InChIKey | QGUPBYVADAJUNT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride?
The IUPAC name of 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride (CID 11019) is 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride.
What is the SMILES notation for 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride?
The canonical SMILES for 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride is CCC(=O)C(CC(C)N1CCOCC1)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride?
The InChIKey is QGUPBYVADAJUNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO2.ClH/c1-3-22(25)23(20-10-6-4-7-11-20,21-12-8-5-9-13-21)18-19(2)24-14-16-26-17-15-24;/h4-13,19H,3,14-18H2,1-2H3;1H.
What are the key properties of 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride?
6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride has a molecular weight of 387.95 g/mol, XLogP of 4.48, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-morpholin-4-yl-4,4-diphenylheptan-3-one;hydrochloride is sourced from PubChem (CID 11019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).