C5H4N4O2 — CID 11019049
1H-imidazo[1,2-a][1,3,5]triazine-2,4-dione (PubChem CID 11019049) has the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. Its IUPAC name is 1H-imidazo[1,2-a][1,3,5]triazine-2,4-dione.
| Compound Name | 1H-imidazo[1,2-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 11019049 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 1H-imidazo[1,2-a][1,3,5]triazine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n2ccnc2[nH]1 |
| InChI | InChI=1S/C5H4N4O2/c10-4-7-3-6-1-2-9(3)5(11)8-4/h1-2H,(H2,6,7,8,10,11) |
| InChIKey | OIWAVYDCTUEOEC-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |