C9H17NO — CID 11019091
[(8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methanol (PubChem CID 11019091) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is [(8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methanol.
| Compound Name | [(8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methanol |
|---|---|
| PubChem CID | 11019091 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | [(8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]methanol |
| SMILES | OC[C@H]1CCCN2CCC[C@H]12 |
| InChI | InChI=1S/C9H17NO/c11-7-8-3-1-5-10-6-2-4-9(8)10/h8-9,11H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | DATGBSBEMJWBMW-RKDXNWHRSA-N |
| XLogP | 0.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |