About 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione
5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione (PubChem CID 110191443) has the molecular formula C8H14N2O4
and a molecular weight of 202.21 g/mol. Its IUPAC name is 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione |
| PubChem CID | 110191443 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione |
| SMILES | COC(CCC1NC(=O)NC1=O)OC |
| InChI | InChI=1S/C8H14N2O4/c1-13-6(14-2)4-3-5-7(11)10-8(12)9-5/h5-6H,3-4H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | AZSUHVOZDRKGIK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione?
The IUPAC name of 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione (CID 110191443) is 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione is COC(CCC1NC(=O)NC1=O)OC.
What is the InChIKey of 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione?
The InChIKey is AZSUHVOZDRKGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4/c1-13-6(14-2)4-3-5-7(11)10-8(12)9-5/h5-6H,3-4H2,1-2H3,(H2,9,10,11,12).
What are the key properties of 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione?
5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione has a molecular weight of 202.21 g/mol, XLogP of -0.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethoxypropyl)imidazolidine-2,4-dione is sourced from PubChem (CID 110191443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).