About (E)-6,6-dimethoxyhex-4-en-3-ol
(E)-6,6-dimethoxyhex-4-en-3-ol (PubChem CID 11019160) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is (E)-6,6-dimethoxyhex-4-en-3-ol.
Molecular Properties
| Compound Name | (E)-6,6-dimethoxyhex-4-en-3-ol |
| PubChem CID | 11019160 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (E)-6,6-dimethoxyhex-4-en-3-ol |
| SMILES | CCC(O)/C=C/C(OC)OC |
| InChI | InChI=1S/C8H16O3/c1-4-7(9)5-6-8(10-2)11-3/h5-9H,4H2,1-3H3/b6-5+ |
| InChIKey | YHYXQKLDUUENHV-AATRIKPKSA-N |
| XLogP | 0.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6,6-dimethoxyhex-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6,6-dimethoxyhex-4-en-3-ol?
The IUPAC name of (E)-6,6-dimethoxyhex-4-en-3-ol (CID 11019160) is (E)-6,6-dimethoxyhex-4-en-3-ol.
What is the SMILES notation for (E)-6,6-dimethoxyhex-4-en-3-ol?
The canonical SMILES for (E)-6,6-dimethoxyhex-4-en-3-ol is CCC(O)/C=C/C(OC)OC.
What is the InChIKey of (E)-6,6-dimethoxyhex-4-en-3-ol?
The InChIKey is YHYXQKLDUUENHV-AATRIKPKSA-N. The full InChI is InChI=1S/C8H16O3/c1-4-7(9)5-6-8(10-2)11-3/h5-9H,4H2,1-3H3/b6-5+.
What are the key properties of (E)-6,6-dimethoxyhex-4-en-3-ol?
(E)-6,6-dimethoxyhex-4-en-3-ol has a molecular weight of 160.21 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6,6-dimethoxyhex-4-en-3-ol is sourced from PubChem (CID 11019160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).