C12H12ClN5O3S4 — CID 110192008
1-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]-3-(2-chlorophenyl)sulfonylurea (PubChem CID 110192008) has the molecular formula C12H12ClN5O3S4 and a molecular weight of 437.98 g/mol. Its IUPAC name is 1-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]-3-(2-chlorophenyl)sulfonylurea.
| Compound Name | 1-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]-3-(2-chlorophenyl)sulfonylurea |
|---|---|
| PubChem CID | 110192008 |
| Molecular Formula | C12H12ClN5O3S4 |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 436.95 |
| IUPAC Name | 1-[[4,6-bis(methylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]-3-(2-chlorophenyl)sulfonylurea |
| SMILES | CSc1nc(SC)nc(SNC(=O)NS(=O)(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H12ClN5O3S4/c1-22-10-14-11(23-2)16-12(15-10)24-17-9(19)18-25(20,21)8-6-4-3-5-7(8)13/h3-6H,1-2H3,(H2,17,18,19) |
| InChIKey | NCVMWLLVZPQARW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|