C16H15F3N4 — CID 110192069
(E)-N-(3,5-dicyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]methanimine (PubChem CID 110192069) has the molecular formula C16H15F3N4 and a molecular weight of 320.32 g/mol. Its IUPAC name is (E)-N-(3,5-dicyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]methanimine.
| Compound Name | (E)-N-(3,5-dicyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 110192069 |
| Molecular Formula | C16H15F3N4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (E)-N-(3,5-dicyclopropyl-1,2,4-triazol-4-yl)-1-[3-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1cccc(/C=N/n2c(C3CC3)nnc2C2CC2)c1 |
| InChI | InChI=1S/C16H15F3N4/c17-16(18,19)13-3-1-2-10(8-13)9-20-23-14(11-4-5-11)21-22-15(23)12-6-7-12/h1-3,8-9,11-12H,4-7H2/b20-9+ |
| InChIKey | SEFZTNAHUBLZJH-AWQFTUOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|