C9H15NO2S2 — CID 110192146
3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbothioic S-acid (PubChem CID 110192146) has the molecular formula C9H15NO2S2 and a molecular weight of 233.36 g/mol. Its IUPAC name is 3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbothioic S-acid.
| Compound Name | 3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbothioic S-acid |
|---|---|
| PubChem CID | 110192146 |
| Molecular Formula | C9H15NO2S2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbothioic S-acid |
| SMILES | CC1(C)SC(C)(C)N(C=O)C1C(=O)S |
| InChI | InChI=1S/C9H15NO2S2/c1-8(2)6(7(12)13)10(5-11)9(3,4)14-8/h5-6H,1-4H3,(H,12,13) |
| InChIKey | FILONIABJYOGRS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|