About 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid
5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 110192231) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 110192231 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCC1NC(C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C9H17NO2S/c1-4-5-6-10-7(8(11)12)9(2,3)13-6/h6-7,10H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | QSRPHCXRPWVHMW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid (CID 110192231) is 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid is CCCC1NC(C(=O)O)C(C)(C)S1.
What is the InChIKey of 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is QSRPHCXRPWVHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-4-5-6-10-7(8(11)12)9(2,3)13-6/h6-7,10H,4-5H2,1-3H3,(H,11,12).
What are the key properties of 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid?
5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 203.31 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-propyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 110192231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).