About 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine
2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine (PubChem CID 110192295) has the molecular formula C11H14Cl2N2
and a molecular weight of 245.15 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine.
Molecular Properties
| Compound Name | 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine |
| PubChem CID | 110192295 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine |
| SMILES | CC1(C)CNC(c2cc(Cl)ccc2Cl)N1 |
| InChI | InChI=1S/C11H14Cl2N2/c1-11(2)6-14-10(15-11)8-5-7(12)3-4-9(8)13/h3-5,10,14-15H,6H2,1-2H3 |
| InChIKey | YYORXSIOFQVCJI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine?
The IUPAC name of 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine (CID 110192295) is 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine.
What is the SMILES notation for 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine?
The canonical SMILES for 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine is CC1(C)CNC(c2cc(Cl)ccc2Cl)N1.
What is the InChIKey of 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine?
The InChIKey is YYORXSIOFQVCJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N2/c1-11(2)6-14-10(15-11)8-5-7(12)3-4-9(8)13/h3-5,10,14-15H,6H2,1-2H3.
What are the key properties of 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine?
2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine has a molecular weight of 245.15 g/mol, XLogP of 2.96, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dichlorophenyl)-4,4-dimethylimidazolidine is sourced from PubChem (CID 110192295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).