About (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane
(2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane (PubChem CID 11019231) has the molecular formula C10H18Si
and a molecular weight of 166.34 g/mol. Its IUPAC name is (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane.
Molecular Properties
| Compound Name | (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane |
| PubChem CID | 11019231 |
| Molecular Formula | C10H18Si |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane |
| SMILES | C=CC1=C([Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C10H18Si/c1-7-8-9(10(8,2)3)11(4,5)6/h7H,1H2,2-6H3 |
| InChIKey | UIELTULEWBAQNW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane?
The IUPAC name of (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane (CID 11019231) is (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane.
What is the SMILES notation for (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane?
The canonical SMILES for (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane is C=CC1=C([Si](C)(C)C)C1(C)C.
What is the InChIKey of (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane?
The InChIKey is UIELTULEWBAQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Si/c1-7-8-9(10(8,2)3)11(4,5)6/h7H,1H2,2-6H3.
What are the key properties of (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane?
(2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane has a molecular weight of 166.34 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethenyl-3,3-dimethylcyclopropen-1-yl)-trimethylsilane is sourced from PubChem (CID 11019231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).