C23H27N5O — CID 110192490
1-cyclohexyl-3-[(2-methyl-2,5-diphenylimidazol-4-yl)amino]urea (PubChem CID 110192490) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2-methyl-2,5-diphenylimidazol-4-yl)amino]urea.
| Compound Name | 1-cyclohexyl-3-[(2-methyl-2,5-diphenylimidazol-4-yl)amino]urea |
|---|---|
| PubChem CID | 110192490 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-cyclohexyl-3-[(2-methyl-2,5-diphenylimidazol-4-yl)amino]urea |
| SMILES | CC1(c2ccccc2)N=C(NNC(=O)NC2CCCCC2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C23H27N5O/c1-23(18-13-7-3-8-14-18)25-20(17-11-5-2-6-12-17)21(26-23)27-28-22(29)24-19-15-9-4-10-16-19/h2-3,5-8,11-14,19H,4,9-10,15-16H2,1H3,(H,26,27)(H2,24,28,29) |
| InChIKey | HXFPFVYCOFGNRX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|