About (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one
(5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one (PubChem CID 11019250) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one.
Molecular Properties
| Compound Name | (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one |
| PubChem CID | 11019250 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one |
| SMILES | C[C@@H]1OCC=C[C@@]12CCC(=O)O2 |
| InChI | InChI=1S/C9H12O3/c1-7-9(4-2-6-11-7)5-3-8(10)12-9/h2,4,7H,3,5-6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | SBIBNWBMWNGLKU-IONNQARKSA-N |
| XLogP | 1.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one?
The IUPAC name of (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one (CID 11019250) is (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one.
What is the SMILES notation for (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one?
The canonical SMILES for (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one is C[C@@H]1OCC=C[C@@]12CCC(=O)O2.
What is the InChIKey of (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one?
The InChIKey is SBIBNWBMWNGLKU-IONNQARKSA-N. The full InChI is InChI=1S/C9H12O3/c1-7-9(4-2-6-11-7)5-3-8(10)12-9/h2,4,7H,3,5-6H2,1H3/t7-,9+/m0/s1.
What are the key properties of (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one?
(5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one has a molecular weight of 168.19 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,10S)-10-methyl-1,9-dioxaspiro[4.5]dec-6-en-2-one is sourced from PubChem (CID 11019250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).