About 2-(2-phenylethynyl)furan
2-(2-phenylethynyl)furan (PubChem CID 11019252) has the molecular formula C12H8O
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(2-phenylethynyl)furan.
Molecular Properties
| Compound Name | 2-(2-phenylethynyl)furan |
| PubChem CID | 11019252 |
| Molecular Formula | C12H8O |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 2-(2-phenylethynyl)furan |
| SMILES | C(#Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C12H8O/c1-2-5-11(6-3-1)8-9-12-7-4-10-13-12/h1-7,10H |
| InChIKey | AEJDDJMEGRMAOY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenylethynyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethynyl)furan?
The IUPAC name of 2-(2-phenylethynyl)furan (CID 11019252) is 2-(2-phenylethynyl)furan.
What is the SMILES notation for 2-(2-phenylethynyl)furan?
The canonical SMILES for 2-(2-phenylethynyl)furan is C(#Cc1ccco1)c1ccccc1.
What is the InChIKey of 2-(2-phenylethynyl)furan?
The InChIKey is AEJDDJMEGRMAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O/c1-2-5-11(6-3-1)8-9-12-7-4-10-13-12/h1-7,10H.
What are the key properties of 2-(2-phenylethynyl)furan?
2-(2-phenylethynyl)furan has a molecular weight of 168.19 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethynyl)furan is sourced from PubChem (CID 11019252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).