C7H14N4O4S — CID 110192593
2-(carbamoylamino)-3-[2-(carbamoylamino)ethylsulfanyl]propanoic acid (PubChem CID 110192593) has the molecular formula C7H14N4O4S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-(carbamoylamino)-3-[2-(carbamoylamino)ethylsulfanyl]propanoic acid.
| Compound Name | 2-(carbamoylamino)-3-[2-(carbamoylamino)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 110192593 |
| Molecular Formula | C7H14N4O4S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-(carbamoylamino)-3-[2-(carbamoylamino)ethylsulfanyl]propanoic acid |
| SMILES | NC(=O)NCCSCC(NC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H14N4O4S/c8-6(14)10-1-2-16-3-4(5(12)13)11-7(9)15/h4H,1-3H2,(H,12,13)(H3,8,10,14)(H3,9,11,15) |
| InChIKey | UREUNFNGDKTOMD-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|