About 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea
1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea (PubChem CID 110192692) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea.
Molecular Properties
| Compound Name | 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea |
| PubChem CID | 110192692 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea |
| SMILES | CNC(=S)NC1C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C11H20N2S/c1-8-5-9(13-10(14)12-4)7-11(2,3)6-8/h5,9H,6-7H2,1-4H3,(H2,12,13,14) |
| InChIKey | BAGZZCIJWDMEJT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea?
The IUPAC name of 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea (CID 110192692) is 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea.
What is the SMILES notation for 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea?
The canonical SMILES for 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea is CNC(=S)NC1C=C(C)CC(C)(C)C1.
What is the InChIKey of 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea?
The InChIKey is BAGZZCIJWDMEJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-8-5-9(13-10(14)12-4)7-11(2,3)6-8/h5,9H,6-7H2,1-4H3,(H2,12,13,14).
What are the key properties of 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea?
1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea has a molecular weight of 212.36 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(3,5,5-trimethylcyclohex-2-en-1-yl)thiourea is sourced from PubChem (CID 110192692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).