About cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid
cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 11019326) has the molecular formula C6H12N4O2
and a molecular weight of 172.19 g/mol. Its IUPAC name is cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 11019326 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | NC(N)=NC[C@@H]1C[C@@]1(N)C(=O)O |
| InChI | InChI=1S/C6H12N4O2/c7-5(8)10-2-3-1-6(3,9)4(11)12/h3H,1-2,9H2,(H,11,12)(H4,7,8,10)/t3-,6-/m0/s1 |
| InChIKey | UKJXPTCZTCDPQL-DZSWIPIPSA-N |
| XLogP | -1.94 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid (CID 11019326) is cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid is NC(N)=NC[C@@H]1C[C@@]1(N)C(=O)O.
What is the InChIKey of cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid?
The InChIKey is UKJXPTCZTCDPQL-DZSWIPIPSA-N. The full InChI is InChI=1S/C6H12N4O2/c7-5(8)10-2-3-1-6(3,9)4(11)12/h3H,1-2,9H2,(H,11,12)(H4,7,8,10)/t3-,6-/m0/s1.
What are the key properties of cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid?
cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid has a molecular weight of 172.19 g/mol, XLogP of -1.94, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 11019326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).