About (4S)-4-phenyl-1,3-oxazolidine-2,5-dione
(4S)-4-phenyl-1,3-oxazolidine-2,5-dione (PubChem CID 11019396) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is (4S)-4-phenyl-1,3-oxazolidine-2,5-dione.
Molecular Properties
| Compound Name | (4S)-4-phenyl-1,3-oxazolidine-2,5-dione |
| PubChem CID | 11019396 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | (4S)-4-phenyl-1,3-oxazolidine-2,5-dione |
| SMILES | O=C1N[C@@H](c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C9H7NO3/c11-8-7(10-9(12)13-8)6-4-2-1-3-5-6/h1-5,7H,(H,10,12)/t7-/m0/s1 |
| InChIKey | ZSEHBLBYCASPDO-ZETCQYMHSA-N |
| XLogP | 0.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-phenyl-1,3-oxazolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-phenyl-1,3-oxazolidine-2,5-dione?
The IUPAC name of (4S)-4-phenyl-1,3-oxazolidine-2,5-dione (CID 11019396) is (4S)-4-phenyl-1,3-oxazolidine-2,5-dione.
What is the SMILES notation for (4S)-4-phenyl-1,3-oxazolidine-2,5-dione?
The canonical SMILES for (4S)-4-phenyl-1,3-oxazolidine-2,5-dione is O=C1N[C@@H](c2ccccc2)C(=O)O1.
What is the InChIKey of (4S)-4-phenyl-1,3-oxazolidine-2,5-dione?
The InChIKey is ZSEHBLBYCASPDO-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H7NO3/c11-8-7(10-9(12)13-8)6-4-2-1-3-5-6/h1-5,7H,(H,10,12)/t7-/m0/s1.
What are the key properties of (4S)-4-phenyl-1,3-oxazolidine-2,5-dione?
(4S)-4-phenyl-1,3-oxazolidine-2,5-dione has a molecular weight of 177.16 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-phenyl-1,3-oxazolidine-2,5-dione is sourced from PubChem (CID 11019396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).