C10H11NO2 — CID 11019399
4-Oxazolemethanol, 4,5-dihydro-2-phenyl-, (4R)- (PubChem CID 11019399) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is [(4R)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol.
| Compound Name | 4-Oxazolemethanol, 4,5-dihydro-2-phenyl-, (4R)- |
|---|---|
| PubChem CID | 11019399 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | [(4R)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol |
| SMILES | C1[C@H](N=C(O1)C2=CC=CC=C2)CO |
| InChI | InChI=1S/C10H11NO2/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-5,9,12H,6-7H2/t9-/m1/s1 |
| InChIKey | NRVMSFKEGIGIHL-SECBINFHSA-N |
| XLogP | 0.80 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 197 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |