About 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole
5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 11019446) has the molecular formula C10H10ClN
and a molecular weight of 179.65 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole |
| PubChem CID | 11019446 |
| Molecular Formula | C10H10ClN |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Clc1ccc(C2=NCCC2)cc1 |
| InChI | InChI=1S/C10H10ClN/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h3-6H,1-2,7H2 |
| InChIKey | RMQRHIVCPGFNHY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole (CID 11019446) is 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole is Clc1ccc(C2=NCCC2)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole?
The InChIKey is RMQRHIVCPGFNHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h3-6H,1-2,7H2.
What are the key properties of 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole?
5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole has a molecular weight of 179.65 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 11019446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).