About 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile
5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile (PubChem CID 110194659) has the molecular formula C12H6FN3OSe
and a molecular weight of 306.16 g/mol. Its IUPAC name is 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile |
| PubChem CID | 110194659 |
| Molecular Formula | C12H6FN3OSe |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile |
| SMILES | N#Cc1c(N)oc2c(-c3ccc(F)cc3)[se]nc12 |
| InChI | InChI=1S/C12H6FN3OSe/c13-7-3-1-6(2-4-7)11-10-9(16-18-11)8(5-14)12(15)17-10/h1-4H,15H2 |
| InChIKey | IDJOHRKRISCQDS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile?
The IUPAC name of 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile (CID 110194659) is 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile.
What is the SMILES notation for 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile?
The canonical SMILES for 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile is N#Cc1c(N)oc2c(-c3ccc(F)cc3)[se]nc12.
What is the InChIKey of 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile?
The InChIKey is IDJOHRKRISCQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6FN3OSe/c13-7-3-1-6(2-4-7)11-10-9(16-18-11)8(5-14)12(15)17-10/h1-4H,15H2.
What are the key properties of 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile?
5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile has a molecular weight of 306.16 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(4-fluorophenyl)furo[3,2-c][1,2]selenazole-6-carbonitrile is sourced from PubChem (CID 110194659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).