C20H18N4O2 — CID 110194663
3-amino-9a-methyl-1-oxo-4-phenyl-4,7,8,9-tetrahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile (PubChem CID 110194663) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-amino-9a-methyl-1-oxo-4-phenyl-4,7,8,9-tetrahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile.
| Compound Name | 3-amino-9a-methyl-1-oxo-4-phenyl-4,7,8,9-tetrahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile |
|---|---|
| PubChem CID | 110194663 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-amino-9a-methyl-1-oxo-4-phenyl-4,7,8,9-tetrahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile |
| SMILES | CC12CCCC=C1OC(c1ccccc1)C1(C#N)C(N)=NC(=O)C21C#N |
| InChI | InChI=1S/C20H18N4O2/c1-18-10-6-5-9-14(18)26-15(13-7-3-2-4-8-13)19(11-21)16(23)24-17(25)20(18,19)12-22/h2-4,7-9,15H,5-6,10H2,1H3,(H2,23,24,25) |
| InChIKey | SFYZHWLCNPHQBX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |